C24H23NO5 — CID 134936266
N-[(1R,5R,6R,7R)-6-(3,4-dimethoxyphenyl)-7-methyl-4,8-dioxo-3-bicyclo[3.2.1]oct-2-enyl]benzamide (PubChem CID 134936266) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[(1R,5R,6R,7R)-6-(3,4-dimethoxyphenyl)-7-methyl-4,8-dioxo-3-bicyclo[3.2.1]oct-2-enyl]benzamide.
| Compound Name | N-[(1R,5R,6R,7R)-6-(3,4-dimethoxyphenyl)-7-methyl-4,8-dioxo-3-bicyclo[3.2.1]oct-2-enyl]benzamide |
|---|---|
| PubChem CID | 134936266 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[(1R,5R,6R,7R)-6-(3,4-dimethoxyphenyl)-7-methyl-4,8-dioxo-3-bicyclo[3.2.1]oct-2-enyl]benzamide |
| SMILES | COc1ccc([C@H]2[C@H]3C(=O)C(NC(=O)c4ccccc4)=C[C@H](C3=O)[C@@H]2C)cc1OC |
| InChI | InChI=1S/C24H23NO5/c1-13-16-12-17(25-24(28)14-7-5-4-6-8-14)23(27)21(22(16)26)20(13)15-9-10-18(29-2)19(11-15)30-3/h4-13,16,20-21H,1-3H3,(H,25,28)/t13-,16-,20-,21+/m0/s1 |
| InChIKey | LEDYTDLEQUZOMR-PWILTOICSA-N |
| XLogP | 3.14 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|