C15H16O6 — CID 150863388
2-(3,4-dimethoxyphenyl)-4,6-dioxocyclohexane-1-carboxylic acid (PubChem CID 150863388) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4,6-dioxocyclohexane-1-carboxylic acid.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4,6-dioxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 150863388 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4,6-dioxocyclohexane-1-carboxylic acid |
| SMILES | COc1ccc(C2CC(=O)CC(=O)C2C(=O)O)cc1OC |
| InChI | InChI=1S/C15H16O6/c1-20-12-4-3-8(5-13(12)21-2)10-6-9(16)7-11(17)14(10)15(18)19/h3-5,10,14H,6-7H2,1-2H3,(H,18,19) |
| InChIKey | KSNOSOHWMOYMRH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|