C14H15BrN2O3 — CID 52903131
(8S)-8-(5-bromo-2-methoxyphenyl)-1-methyl-2,6-diazabicyclo[2.2.2]octane-3,5-dione (PubChem CID 52903131) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is (8S)-8-(5-bromo-2-methoxyphenyl)-1-methyl-2,6-diazabicyclo[2.2.2]octane-3,5-dione.
| Compound Name | (8S)-8-(5-bromo-2-methoxyphenyl)-1-methyl-2,6-diazabicyclo[2.2.2]octane-3,5-dione |
|---|---|
| PubChem CID | 52903131 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | (8S)-8-(5-bromo-2-methoxyphenyl)-1-methyl-2,6-diazabicyclo[2.2.2]octane-3,5-dione |
| SMILES | COc1ccc(Br)cc1[C@H]1CC2(C)NC(=O)C1C(=O)N2 |
| InChI | InChI=1S/C14H15BrN2O3/c1-14-6-9(11(12(18)16-14)13(19)17-14)8-5-7(15)3-4-10(8)20-2/h3-5,9,11H,6H2,1-2H3,(H,16,18)(H,17,19)/t9-,11?,14?/m1/s1 |
| InChIKey | DEMHVRFMNBQOIJ-FDMSEYEVSA-N |
| XLogP | 1.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|