C24H26Br2O2 — CID 169434565
(2S,7S)-1,2-bis(5-bromo-2-methoxyphenyl)adamantane (PubChem CID 169434565) has the molecular formula C24H26Br2O2 and a molecular weight of 506.28 g/mol. Its IUPAC name is (2S,7S)-1,2-bis(5-bromo-2-methoxyphenyl)adamantane.
| Compound Name | (2S,7S)-1,2-bis(5-bromo-2-methoxyphenyl)adamantane |
|---|---|
| PubChem CID | 169434565 |
| Molecular Formula | C24H26Br2O2 |
| Molecular Weight | 506.28 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | (2S,7S)-1,2-bis(5-bromo-2-methoxyphenyl)adamantane |
| SMILES | COc1ccc(Br)cc1[C@H]1C2CC3C[C@@H](C2)CC1(c1cc(Br)ccc1OC)C3 |
| InChI | InChI=1S/C24H26Br2O2/c1-27-21-5-3-17(25)10-19(21)23-16-8-14-7-15(9-16)13-24(23,12-14)20-11-18(26)4-6-22(20)28-2/h3-6,10-11,14-16,23H,7-9,12-13H2,1-2H3/t14-,15?,16?,23+,24?/m0/s1 |
| InChIKey | IUNUCZNTHIXMTP-CJIYAYHQSA-N |
| XLogP | 7.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.28 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |