C18H22Br2O — CID 63435492
1-[bromo-(5-bromo-2-methoxyphenyl)methyl]adamantane (PubChem CID 63435492) has the molecular formula C18H22Br2O and a molecular weight of 414.18 g/mol. Its IUPAC name is 1-[bromo-(5-bromo-2-methoxyphenyl)methyl]adamantane.
| Compound Name | 1-[bromo-(5-bromo-2-methoxyphenyl)methyl]adamantane |
|---|---|
| PubChem CID | 63435492 |
| Molecular Formula | C18H22Br2O |
| Molecular Weight | 414.18 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | 1-[bromo-(5-bromo-2-methoxyphenyl)methyl]adamantane |
| SMILES | COc1ccc(Br)cc1C(Br)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H22Br2O/c1-21-16-3-2-14(19)7-15(16)17(20)18-8-11-4-12(9-18)6-13(5-11)10-18/h2-3,7,11-13,17H,4-6,8-10H2,1H3 |
| InChIKey | IVJSJXOYDWQEQT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.18 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|