C15H20Br2O — CID 66476577
4-bromo-2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]-1-methoxybenzene (PubChem CID 66476577) has the molecular formula C15H20Br2O and a molecular weight of 376.13 g/mol. Its IUPAC name is 4-bromo-2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]-1-methoxybenzene.
| Compound Name | 4-bromo-2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]-1-methoxybenzene |
|---|---|
| PubChem CID | 66476577 |
| Molecular Formula | C15H20Br2O |
| Molecular Weight | 376.13 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 4-bromo-2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]-1-methoxybenzene |
| SMILES | COc1ccc(Br)cc1C(Br)C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C15H20Br2O/c1-14(2)13(15(14,3)4)12(17)10-8-9(16)6-7-11(10)18-5/h6-8,12-13H,1-5H3 |
| InChIKey | MWBHEBLTPHYSQE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.13 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|