C14H17Br3 — CID 66476769
1,4-dibromo-2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]benzene (PubChem CID 66476769) has the molecular formula C14H17Br3 and a molecular weight of 425.00 g/mol. Its IUPAC name is 1,4-dibromo-2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]benzene.
| Compound Name | 1,4-dibromo-2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]benzene |
|---|---|
| PubChem CID | 66476769 |
| Molecular Formula | C14H17Br3 |
| Molecular Weight | 425.00 g/mol |
| Exact Mass | 421.89 |
| IUPAC Name | 1,4-dibromo-2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]benzene |
| SMILES | CC1(C)C(C(Br)c2cc(Br)ccc2Br)C1(C)C |
| InChI | InChI=1S/C14H17Br3/c1-13(2)12(14(13,3)4)11(17)9-7-8(15)5-6-10(9)16/h5-7,11-12H,1-4H3 |
| InChIKey | MQRLFJWSOUYRGX-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.00 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|