C12H16Br2S — CID 80537266
3-bromo-2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]thiophene (PubChem CID 80537266) has the molecular formula C12H16Br2S and a molecular weight of 352.14 g/mol. Its IUPAC name is 3-bromo-2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]thiophene.
| Compound Name | 3-bromo-2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]thiophene |
|---|---|
| PubChem CID | 80537266 |
| Molecular Formula | C12H16Br2S |
| Molecular Weight | 352.14 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | 3-bromo-2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]thiophene |
| SMILES | CC1(C)C(C(Br)c2sccc2Br)C1(C)C |
| InChI | InChI=1S/C12H16Br2S/c1-11(2)10(12(11,3)4)8(14)9-7(13)5-6-15-9/h5-6,8,10H,1-4H3 |
| InChIKey | SBTQEDLGOFDAJU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.14 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|