C12H16BrClS — CID 80530641
2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]-3-chlorothiophene (PubChem CID 80530641) has the molecular formula C12H16BrClS and a molecular weight of 307.68 g/mol. Its IUPAC name is 2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]-3-chlorothiophene.
| Compound Name | 2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]-3-chlorothiophene |
|---|---|
| PubChem CID | 80530641 |
| Molecular Formula | C12H16BrClS |
| Molecular Weight | 307.68 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 2-[bromo-(2,2,3,3-tetramethylcyclopropyl)methyl]-3-chlorothiophene |
| SMILES | CC1(C)C(C(Br)c2sccc2Cl)C1(C)C |
| InChI | InChI=1S/C12H16BrClS/c1-11(2)10(12(11,3)4)8(13)9-7(14)5-6-15-9/h5-6,8,10H,1-4H3 |
| InChIKey | RYWYQMXQTFEEJL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.68 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|