C15H18BrNO5 — CID 118435868
5-(5-bromo-2-methoxyphenyl)-4-methoxycarbonyl-4-methylpyrrolidine-2-carboxylic acid (PubChem CID 118435868) has the molecular formula C15H18BrNO5 and a molecular weight of 372.22 g/mol. Its IUPAC name is 5-(5-bromo-2-methoxyphenyl)-4-methoxycarbonyl-4-methylpyrrolidine-2-carboxylic acid.
| Compound Name | 5-(5-bromo-2-methoxyphenyl)-4-methoxycarbonyl-4-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 118435868 |
| Molecular Formula | C15H18BrNO5 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 5-(5-bromo-2-methoxyphenyl)-4-methoxycarbonyl-4-methylpyrrolidine-2-carboxylic acid |
| SMILES | COC(=O)C1(C)CC(C(=O)O)NC1c1cc(Br)ccc1OC |
| InChI | InChI=1S/C15H18BrNO5/c1-15(14(20)22-3)7-10(13(18)19)17-12(15)9-6-8(16)4-5-11(9)21-2/h4-6,10,12,17H,7H2,1-3H3,(H,18,19) |
| InChIKey | XIRFYPHAFBHKRN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |