C20H25BrN2O5S2 — CID 126565458
methyl (6S,7S,8aS)-6-(5-bromo-2-methoxyphenyl)-8a-[ethyl(methyl)carbamoyl]-7-methyl-4-oxo-6,8-dihydropyrrolo[2,1-c][1,2,4]dithiazine-7-carboxylate (PubChem CID 126565458) has the molecular formula C20H25BrN2O5S2 and a molecular weight of 517.47 g/mol. Its IUPAC name is methyl (6S,7S,8aS)-6-(5-bromo-2-methoxyphenyl)-8a-[ethyl(methyl)carbamoyl]-7-methyl-4-oxo-6,8-dihydropyrrolo[2,1-c][1,2,4]dithiazine-7-carboxylate.
| Compound Name | methyl (6S,7S,8aS)-6-(5-bromo-2-methoxyphenyl)-8a-[ethyl(methyl)carbamoyl]-7-methyl-4-oxo-6,8-dihydropyrrolo[2,1-c][1,2,4]dithiazine-7-carboxylate |
|---|---|
| PubChem CID | 126565458 |
| Molecular Formula | C20H25BrN2O5S2 |
| Molecular Weight | 517.47 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | methyl (6S,7S,8aS)-6-(5-bromo-2-methoxyphenyl)-8a-[ethyl(methyl)carbamoyl]-7-methyl-4-oxo-6,8-dihydropyrrolo[2,1-c][1,2,4]dithiazine-7-carboxylate |
| SMILES | CCN(C)C(=O)[C@@]12C[C@](C)(C(=O)OC)[C@H](c3cc(Br)ccc3OC)N1C(=O)CSS2 |
| InChI | InChI=1S/C20H25BrN2O5S2/c1-6-22(3)17(25)20-11-19(2,18(26)28-5)16(23(20)15(24)10-29-30-20)13-9-12(21)7-8-14(13)27-4/h7-9,16H,6,10-11H2,1-5H3/t16-,19-,20-/m0/s1 |
| InChIKey | UBSAWKPOSWLXAL-VDGAXYAQSA-N |
| XLogP | 3.48 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|