C25H27ClNO+ — CID 7364184
(2S,3R,4R,6S)-4-[(2-chlorophenyl)methyl]-3-methyl-2,6-diphenylpiperidin-1-ium-4-ol (PubChem CID 7364184) has the molecular formula C25H27ClNO+ and a molecular weight of 392.95 g/mol. Its IUPAC name is (2S,3R,4R,6S)-4-[(2-chlorophenyl)methyl]-3-methyl-2,6-diphenylpiperidin-1-ium-4-ol.
| Compound Name | (2S,3R,4R,6S)-4-[(2-chlorophenyl)methyl]-3-methyl-2,6-diphenylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7364184 |
| Molecular Formula | C25H27ClNO+ |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (2S,3R,4R,6S)-4-[(2-chlorophenyl)methyl]-3-methyl-2,6-diphenylpiperidin-1-ium-4-ol |
| SMILES | C[C@@H]1[C@@H](c2ccccc2)[NH2+][C@H](c2ccccc2)C[C@]1(O)Cc1ccccc1Cl |
| InChI | InChI=1S/C25H26ClNO/c1-18-24(20-12-6-3-7-13-20)27-23(19-10-4-2-5-11-19)17-25(18,28)16-21-14-8-9-15-22(21)26/h2-15,18,23-24,27-28H,16-17H2,1H3/p+1/t18-,23+,24+,25-/m1/s1 |
| InChIKey | BEWVWNGYSGPFME-XELASAAXSA-O |
| XLogP | 4.70 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |