C22H27NO3 — CID 7104544
(2R,3R,6S)-2,6-bis(4-methoxyphenyl)-3-propylpiperidin-4-one (PubChem CID 7104544) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (2R,3R,6S)-2,6-bis(4-methoxyphenyl)-3-propylpiperidin-4-one.
| Compound Name | (2R,3R,6S)-2,6-bis(4-methoxyphenyl)-3-propylpiperidin-4-one |
|---|---|
| PubChem CID | 7104544 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (2R,3R,6S)-2,6-bis(4-methoxyphenyl)-3-propylpiperidin-4-one |
| SMILES | CCC[C@H]1C(=O)C[C@@H](c2ccc(OC)cc2)NC1c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H27NO3/c1-4-5-19-21(24)14-20(15-6-10-17(25-2)11-7-15)23-22(19)16-8-12-18(26-3)13-9-16/h6-13,19-20,22-23H,4-5,14H2,1-3H3/t19-,20-,22?/m0/s1 |
| InChIKey | XVELDBZHBLEZHS-ZDOMSUIMSA-N |
| XLogP | 4.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |