C12H16NO+ — CID 6942386
(2R,3R)-3-methyl-2-phenylpiperidin-1-ium-4-one (PubChem CID 6942386) has the molecular formula C12H16NO+ and a molecular weight of 190.27 g/mol. Its IUPAC name is (2R,3R)-3-methyl-2-phenylpiperidin-1-ium-4-one.
| Compound Name | (2R,3R)-3-methyl-2-phenylpiperidin-1-ium-4-one |
|---|---|
| PubChem CID | 6942386 |
| Molecular Formula | C12H16NO+ |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (2R,3R)-3-methyl-2-phenylpiperidin-1-ium-4-one |
| SMILES | C[C@H]1C(=O)CC[NH2+][C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H15NO/c1-9-11(14)7-8-13-12(9)10-5-3-2-4-6-10/h2-6,9,12-13H,7-8H2,1H3/p+1/t9-,12+/m0/s1 |
| InChIKey | WXIFLNDOTSRSQF-JOYOIKCWSA-O |
| XLogP | 0.90 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |