C13H14O3 — CID 134972896
(5S,7R)-2-methyl-7-phenyl-6,8-dioxabicyclo[3.2.1]octan-3-one (PubChem CID 134972896) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (5S,7R)-2-methyl-7-phenyl-6,8-dioxabicyclo[3.2.1]octan-3-one.
| Compound Name | (5S,7R)-2-methyl-7-phenyl-6,8-dioxabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 134972896 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (5S,7R)-2-methyl-7-phenyl-6,8-dioxabicyclo[3.2.1]octan-3-one |
| SMILES | CC1C(=O)C[C@H]2OC1[C@@H](c1ccccc1)O2 |
| InChI | InChI=1S/C13H14O3/c1-8-10(14)7-11-15-12(8)13(16-11)9-5-3-2-4-6-9/h2-6,8,11-13H,7H2,1H3/t8?,11-,12?,13+/m0/s1 |
| InChIKey | ULOQGEOQCGYFQM-YFNMYLJCSA-N |
| XLogP | 2.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |