C13H12O4 — CID 44605290
(1S,2S,4R,5R,7R)-4-phenyl-3,6,10-trioxatricyclo[5.3.0.02,5]decan-9-one (PubChem CID 44605290) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is (1S,2S,4R,5R,7R)-4-phenyl-3,6,10-trioxatricyclo[5.3.0.02,5]decan-9-one.
| Compound Name | (1S,2S,4R,5R,7R)-4-phenyl-3,6,10-trioxatricyclo[5.3.0.02,5]decan-9-one |
|---|---|
| PubChem CID | 44605290 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (1S,2S,4R,5R,7R)-4-phenyl-3,6,10-trioxatricyclo[5.3.0.02,5]decan-9-one |
| SMILES | O=C1C[C@H]2O[C@H]3[C@H](O[C@@H]3c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C13H12O4/c14-9-6-8-11(16-9)13-12(15-8)10(17-13)7-4-2-1-3-5-7/h1-5,8,10-13H,6H2/t8-,10-,11+,12-,13-/m1/s1 |
| InChIKey | CXOKPQOVJYJANA-KABOQKQYSA-N |
| XLogP | 1.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |