C14H13O5Tc- — CID 59492014
4-methanidyl-4-phenyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one;technetium (PubChem CID 59492014) has the molecular formula C14H13O5Tc- and a molecular weight of 359.25 g/mol. Its IUPAC name is 4-methanidyl-4-phenyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one;technetium.
| Compound Name | 4-methanidyl-4-phenyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one;technetium |
|---|---|
| PubChem CID | 59492014 |
| Molecular Formula | C14H13O5Tc- |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 4-methanidyl-4-phenyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one;technetium |
| SMILES | [CH2-]C1(c2ccccc2)OC2OC3CC(=O)OC3C2O1.[Tc] |
| InChI | InChI=1S/C14H13O5.Tc/c1-14(8-5-3-2-4-6-8)18-12-11-9(7-10(15)17-11)16-13(12)19-14;/h2-6,9,11-13H,1,7H2;/q-1; |
| InChIKey | UINNTTCLCKVFAE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|