C14H20NO2+ — CID 7144552
propan-2-yl (2S,3S)-2-phenylpyrrolidin-1-ium-3-carboxylate (PubChem CID 7144552) has the molecular formula C14H20NO2+ and a molecular weight of 234.32 g/mol. Its IUPAC name is propan-2-yl (2S,3S)-2-phenylpyrrolidin-1-ium-3-carboxylate.
| Compound Name | propan-2-yl (2S,3S)-2-phenylpyrrolidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 7144552 |
| Molecular Formula | C14H20NO2+ |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | propan-2-yl (2S,3S)-2-phenylpyrrolidin-1-ium-3-carboxylate |
| SMILES | CC(C)OC(=O)[C@H]1CC[NH2+][C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-10(2)17-14(16)12-8-9-15-13(12)11-6-4-3-5-7-11/h3-7,10,12-13,15H,8-9H2,1-2H3/p+1/t12-,13+/m0/s1 |
| InChIKey | RWQUVOWLQIPGFC-QWHCGFSZSA-O |
| XLogP | 1.26 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |