C14H22O4 — CID 135076084
dipropan-2-yl (1R,2S)-cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 135076084) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is dipropan-2-yl (1R,2S)-cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dipropan-2-yl (1R,2S)-cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 135076084 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | dipropan-2-yl (1R,2S)-cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CC(C)OC(=O)[C@H]1CC=CC[C@H]1C(=O)OC(C)C |
| InChI | InChI=1S/C14H22O4/c1-9(2)17-13(15)11-7-5-6-8-12(11)14(16)18-10(3)4/h5-6,9-12H,7-8H2,1-4H3/t11-,12+ |
| InChIKey | HYVFXKUAIQVWFZ-TXEJJXNPSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|