C24H42O4 — CID 69473549
dioctan-2-yl cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 69473549) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is dioctan-2-yl cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dioctan-2-yl cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 69473549 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | dioctan-2-yl cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CCCCCCC(C)OC(=O)C1CC=CCC1C(=O)OC(C)CCCCCC |
| InChI | InChI=1S/C24H42O4/c1-5-7-9-11-15-19(3)27-23(25)21-17-13-14-18-22(21)24(26)28-20(4)16-12-10-8-6-2/h13-14,19-22H,5-12,15-18H2,1-4H3 |
| InChIKey | ROEGICWKAHVNNU-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|