About CID 158946872
CID 158946872 (PubChem CID 158946872) has the molecular formula C17H32NaO3
and a molecular weight of 307.43 g/mol.
Molecular Properties
| Compound Name | CID 158946872 |
| PubChem CID | 158946872 |
| Molecular Formula | C17H32NaO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCCCC(C)OC(=O)C1CO1.[Na] |
| InChI | InChI=1S/C17H32O3.Na/c1-3-4-5-6-7-8-9-10-11-12-13-15(2)20-17(18)16-14-19-16;/h15-16H,3-14H2,1-2H3; |
| InChIKey | JKXVRMYESNKCAQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 158946872 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158946872?
The IUPAC name of CID 158946872 (CID 158946872) is not available.
What is the SMILES notation for CID 158946872?
The canonical SMILES for CID 158946872 is CCCCCCCCCCCCC(C)OC(=O)C1CO1.[Na].
What is the InChIKey of CID 158946872?
The InChIKey is JKXVRMYESNKCAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O3.Na/c1-3-4-5-6-7-8-9-10-11-12-13-15(2)20-17(18)16-14-19-16;/h15-16H,3-14H2,1-2H3;.
What are the key properties of CID 158946872?
CID 158946872 has a molecular weight of 307.43 g/mol, XLogP of 4.25, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158946872 is sourced from PubChem (CID 158946872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).