C20H24N2O3S — CID 4249371
propan-2-yl 6-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 4249371) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is propan-2-yl 6-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | propan-2-yl 6-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 4249371 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | propan-2-yl 6-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CC(C)OC(=O)C1CC=CCC1C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C20H24N2O3S/c1-12(2)25-20(24)15-9-4-3-8-14(15)18(23)22-19-16(11-21)13-7-5-6-10-17(13)26-19/h3-4,12,14-15H,5-10H2,1-2H3,(H,22,23) |
| InChIKey | VTMBQXBMZVAOJR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|