C14H19IO2 — CID 15457978
(2S,3S,4R,5S)-5-butyl-4-iodo-2-phenyloxolan-3-ol (PubChem CID 15457978) has the molecular formula C14H19IO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is (2S,3S,4R,5S)-5-butyl-4-iodo-2-phenyloxolan-3-ol.
| Compound Name | (2S,3S,4R,5S)-5-butyl-4-iodo-2-phenyloxolan-3-ol |
|---|---|
| PubChem CID | 15457978 |
| Molecular Formula | C14H19IO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | (2S,3S,4R,5S)-5-butyl-4-iodo-2-phenyloxolan-3-ol |
| SMILES | CCCC[C@@H]1O[C@@H](c2ccccc2)[C@H](O)[C@H]1I |
| InChI | InChI=1S/C14H19IO2/c1-2-3-9-11-12(15)13(16)14(17-11)10-7-5-4-6-8-10/h4-8,11-14,16H,2-3,9H2,1H3/t11-,12-,13+,14-/m0/s1 |
| InChIKey | SWIAOWPRDBNBEE-FQUUOJAGSA-N |
| XLogP | 3.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|