C13H14I2O — CID 154711489
3,4-diiodo-2-phenyl-5-propyl-2,5-dihydrofuran (PubChem CID 154711489) has the molecular formula C13H14I2O and a molecular weight of 440.06 g/mol. Its IUPAC name is 3,4-diiodo-2-phenyl-5-propyl-2,5-dihydrofuran.
| Compound Name | 3,4-diiodo-2-phenyl-5-propyl-2,5-dihydrofuran |
|---|---|
| PubChem CID | 154711489 |
| Molecular Formula | C13H14I2O |
| Molecular Weight | 440.06 g/mol |
| Exact Mass | 439.91 |
| IUPAC Name | 3,4-diiodo-2-phenyl-5-propyl-2,5-dihydrofuran |
| SMILES | CCCC1OC(c2ccccc2)C(I)=C1I |
| InChI | InChI=1S/C13H14I2O/c1-2-6-10-11(14)12(15)13(16-10)9-7-4-3-5-8-9/h3-5,7-8,10,13H,2,6H2,1H3 |
| InChIKey | UBEMBQOYMIDIEL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.06 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|