C20H23NO2 — CID 102009380
(5R)-4-benzyl-5-phenyl-3-propylmorpholin-2-one (PubChem CID 102009380) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (5R)-4-benzyl-5-phenyl-3-propylmorpholin-2-one.
| Compound Name | (5R)-4-benzyl-5-phenyl-3-propylmorpholin-2-one |
|---|---|
| PubChem CID | 102009380 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (5R)-4-benzyl-5-phenyl-3-propylmorpholin-2-one |
| SMILES | CCCC1C(=O)OC[C@@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c1-2-9-18-20(22)23-15-19(17-12-7-4-8-13-17)21(18)14-16-10-5-3-6-11-16/h3-8,10-13,18-19H,2,9,14-15H2,1H3/t18?,19-/m0/s1 |
| InChIKey | WRMCPTXQZQKJEF-GGYWPGCISA-N |
| XLogP | 3.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |