C20H19NOS — CID 11782223
(2R,4R)-3-benzyl-4-phenyl-2-thiophen-2-yl-1,3-oxazolidine (PubChem CID 11782223) has the molecular formula C20H19NOS and a molecular weight of 321.45 g/mol. Its IUPAC name is (2R,4R)-3-benzyl-4-phenyl-2-thiophen-2-yl-1,3-oxazolidine.
| Compound Name | (2R,4R)-3-benzyl-4-phenyl-2-thiophen-2-yl-1,3-oxazolidine |
|---|---|
| PubChem CID | 11782223 |
| Molecular Formula | C20H19NOS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (2R,4R)-3-benzyl-4-phenyl-2-thiophen-2-yl-1,3-oxazolidine |
| SMILES | c1ccc(CN2[C@@H](c3cccs3)OC[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19NOS/c1-3-8-16(9-4-1)14-21-18(17-10-5-2-6-11-17)15-22-20(21)19-12-7-13-23-19/h1-13,18,20H,14-15H2/t18-,20+/m0/s1 |
| InChIKey | LIKZMIKYRDHXCC-AZUAARDMSA-N |
| XLogP | 5.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |