C19H18N2O3 — CID 101131885
(3R,8aR)-7-benzyl-3-phenyl-1,3,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-5,8-dione (PubChem CID 101131885) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is (3R,8aR)-7-benzyl-3-phenyl-1,3,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-5,8-dione.
| Compound Name | (3R,8aR)-7-benzyl-3-phenyl-1,3,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-5,8-dione |
|---|---|
| PubChem CID | 101131885 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (3R,8aR)-7-benzyl-3-phenyl-1,3,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-5,8-dione |
| SMILES | O=C1[C@H]2CO[C@H](c3ccccc3)N2C(=O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C19H18N2O3/c22-17-12-20(11-14-7-3-1-4-8-14)18(23)16-13-24-19(21(16)17)15-9-5-2-6-10-15/h1-10,16,19H,11-13H2/t16-,19-/m1/s1 |
| InChIKey | ODTZHBTZWOCGJE-VQIMIIECSA-N |
| XLogP | 1.96 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |