C20H20N2O2S — CID 11256682
(1R,3R,8aS)-7-benzyl-1-methyl-3-phenyl-5-sulfanylidene-1,3,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-8-one (PubChem CID 11256682) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is (1R,3R,8aS)-7-benzyl-1-methyl-3-phenyl-5-sulfanylidene-1,3,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-8-one.
| Compound Name | (1R,3R,8aS)-7-benzyl-1-methyl-3-phenyl-5-sulfanylidene-1,3,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-8-one |
|---|---|
| PubChem CID | 11256682 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (1R,3R,8aS)-7-benzyl-1-methyl-3-phenyl-5-sulfanylidene-1,3,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-8-one |
| SMILES | C[C@H]1O[C@H](c2ccccc2)N2C(=S)CN(Cc3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C20H20N2O2S/c1-14-18-19(23)21(12-15-8-4-2-5-9-15)13-17(25)22(18)20(24-14)16-10-6-3-7-11-16/h2-11,14,18,20H,12-13H2,1H3/t14-,18+,20-/m1/s1 |
| InChIKey | AEVXECFQHVFYPC-HEFCMCLBSA-N |
| XLogP | 3.14 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|