C20H20N2O3 — CID 11772039
(1R,3S,8aS)-7-benzyl-1-methyl-3-phenyl-1,3,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-5,8-dione (PubChem CID 11772039) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (1R,3S,8aS)-7-benzyl-1-methyl-3-phenyl-1,3,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-5,8-dione.
| Compound Name | (1R,3S,8aS)-7-benzyl-1-methyl-3-phenyl-1,3,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-5,8-dione |
|---|---|
| PubChem CID | 11772039 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (1R,3S,8aS)-7-benzyl-1-methyl-3-phenyl-1,3,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-5,8-dione |
| SMILES | C[C@H]1O[C@@H](c2ccccc2)N2C(=O)CN(Cc3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C20H20N2O3/c1-14-18-19(24)21(12-15-8-4-2-5-9-15)13-17(23)22(18)20(25-14)16-10-6-3-7-11-16/h2-11,14,18,20H,12-13H2,1H3/t14-,18+,20+/m1/s1 |
| InChIKey | NSLHHSKYBIXYQL-WNYOCNMUSA-N |
| XLogP | 2.34 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |