C14H14ClNO2 — CID 11708726
(1S,2R,3S,4S,7R)-3-(chloromethyl)-7-phenyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one (PubChem CID 11708726) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is (1S,2R,3S,4S,7R)-3-(chloromethyl)-7-phenyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one.
| Compound Name | (1S,2R,3S,4S,7R)-3-(chloromethyl)-7-phenyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one |
|---|---|
| PubChem CID | 11708726 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | (1S,2R,3S,4S,7R)-3-(chloromethyl)-7-phenyl-8-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one |
| SMILES | O=C1[C@@H]2[C@@H](CCl)[C@@H]2[C@H]2CO[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C14H14ClNO2/c15-6-9-11-10-7-18-14(8-4-2-1-3-5-8)16(10)13(17)12(9)11/h1-5,9-12,14H,6-7H2/t9-,10+,11+,12+,14+/m0/s1 |
| InChIKey | BFRBDZBPBBNQEA-WRYZSIRCSA-N |
| XLogP | 2.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|