C13H12N2O2 — CID 11470206
(3R,7S,7aS)-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-7-carbonitrile (PubChem CID 11470206) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is (3R,7S,7aS)-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-7-carbonitrile.
| Compound Name | (3R,7S,7aS)-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-7-carbonitrile |
|---|---|
| PubChem CID | 11470206 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | (3R,7S,7aS)-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-7-carbonitrile |
| SMILES | N#C[C@H]1CC(=O)N2[C@@H](c3ccccc3)OC[C@H]12 |
| InChI | InChI=1S/C13H12N2O2/c14-7-10-6-12(16)15-11(10)8-17-13(15)9-4-2-1-3-5-9/h1-5,10-11,13H,6,8H2/t10-,11-,13-/m1/s1 |
| InChIKey | HJRBCVFKVCNQJF-NQBHXWOUSA-N |
| XLogP | 1.46 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |