C13H14N2O3 — CID 11357028
(3R,7S,7aS)-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-7-carboxamide (PubChem CID 11357028) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is (3R,7S,7aS)-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-7-carboxamide.
| Compound Name | (3R,7S,7aS)-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-7-carboxamide |
|---|---|
| PubChem CID | 11357028 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (3R,7S,7aS)-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-7-carboxamide |
| SMILES | NC(=O)[C@H]1CC(=O)N2[C@@H](c3ccccc3)OC[C@H]12 |
| InChI | InChI=1S/C13H14N2O3/c14-12(17)9-6-11(16)15-10(9)7-18-13(15)8-4-2-1-3-5-8/h1-5,9-10,13H,6-7H2,(H2,14,17)/t9-,10+,13+/m0/s1 |
| InChIKey | DGMHNLTVAIVZMX-OPQQBVKSSA-N |
| XLogP | 0.42 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |