C17H19NO7 — CID 12995490
ethyl (3R,6R,7R,7aR)-7-acetyloxy-6-hydroxy-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 12995490) has the molecular formula C17H19NO7 and a molecular weight of 349.34 g/mol. Its IUPAC name is ethyl (3R,6R,7R,7aR)-7-acetyloxy-6-hydroxy-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | ethyl (3R,6R,7R,7aR)-7-acetyloxy-6-hydroxy-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 12995490 |
| Molecular Formula | C17H19NO7 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | ethyl (3R,6R,7R,7aR)-7-acetyloxy-6-hydroxy-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | CCOC(=O)[C@]1(O)C(=O)N2[C@@H](c3ccccc3)OC[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H19NO7/c1-3-23-16(21)17(22)13(25-10(2)19)12-9-24-14(18(12)15(17)20)11-7-5-4-6-8-11/h4-8,12-14,22H,3,9H2,1-2H3/t12-,13-,14-,17-/m1/s1 |
| InChIKey | BSPCSAYFRSVKKK-VMUDFCTBSA-N |
| XLogP | 0.15 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|