C28H33NO6 — CID 10719473
ethyl (3R,6S,7S,7aS)-6-benzyl-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 10719473) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is ethyl (3R,6S,7S,7aS)-6-benzyl-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | ethyl (3R,6S,7S,7aS)-6-benzyl-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 10719473 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | ethyl (3R,6S,7S,7aS)-6-benzyl-7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-oxo-3-phenyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2ccccc2)C(=O)N2[C@@H](c3ccccc3)OC[C@@H]2[C@H]1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H33NO6/c1-5-33-26(32)28(17-19-12-8-6-9-13-19)21(16-23(30)35-27(2,3)4)22-18-34-24(29(22)25(28)31)20-14-10-7-11-15-20/h6-15,21-22,24H,5,16-18H2,1-4H3/t21-,22-,24-,28+/m1/s1 |
| InChIKey | RZBXNGYDGSBIPK-WQMAXLQNSA-N |
| XLogP | 4.07 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|