C31H30Cl2N2O2 — CID 22674529
3-benzhydryl-1,4-dibenzylpiperazine-2,5-dione;dihydrochloride (PubChem CID 22674529) has the molecular formula C31H30Cl2N2O2 and a molecular weight of 533.50 g/mol. Its IUPAC name is 3-benzhydryl-1,4-dibenzylpiperazine-2,5-dione;dihydrochloride.
| Compound Name | 3-benzhydryl-1,4-dibenzylpiperazine-2,5-dione;dihydrochloride |
|---|---|
| PubChem CID | 22674529 |
| Molecular Formula | C31H30Cl2N2O2 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 3-benzhydryl-1,4-dibenzylpiperazine-2,5-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C1C(C(c2ccccc2)c2ccccc2)N(Cc2ccccc2)C(=O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C31H28N2O2.2ClH/c34-28-23-32(21-24-13-5-1-6-14-24)31(35)30(33(28)22-25-15-7-2-8-16-25)29(26-17-9-3-10-18-26)27-19-11-4-12-20-27;;/h1-20,29-30H,21-23H2;2*1H |
| InChIKey | ZVIJIBXKYDZEDM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |