C13H12OS — CID 134996090
(2S,3R)-2-benzyl-3-thiophen-2-yloxirane (PubChem CID 134996090) has the molecular formula C13H12OS and a molecular weight of 216.31 g/mol. Its IUPAC name is (2S,3R)-2-benzyl-3-thiophen-2-yloxirane.
| Compound Name | (2S,3R)-2-benzyl-3-thiophen-2-yloxirane |
|---|---|
| PubChem CID | 134996090 |
| Molecular Formula | C13H12OS |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (2S,3R)-2-benzyl-3-thiophen-2-yloxirane |
| SMILES | c1ccc(C[C@@H]2O[C@H]2c2cccs2)cc1 |
| InChI | InChI=1S/C13H12OS/c1-2-5-10(6-3-1)9-11-13(14-11)12-7-4-8-15-12/h1-8,11,13H,9H2/t11-,13+/m0/s1 |
| InChIKey | YQOLBKBHDXVGJO-WCQYABFASA-N |
| XLogP | 3.43 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|