C26H23NOS — CID 10408518
(4R)-3-benzhydryl-4-phenyl-2-thiophen-2-yl-1,3-oxazolidine (PubChem CID 10408518) has the molecular formula C26H23NOS and a molecular weight of 397.54 g/mol. Its IUPAC name is (4R)-3-benzhydryl-4-phenyl-2-thiophen-2-yl-1,3-oxazolidine.
| Compound Name | (4R)-3-benzhydryl-4-phenyl-2-thiophen-2-yl-1,3-oxazolidine |
|---|---|
| PubChem CID | 10408518 |
| Molecular Formula | C26H23NOS |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (4R)-3-benzhydryl-4-phenyl-2-thiophen-2-yl-1,3-oxazolidine |
| SMILES | c1ccc(C(c2ccccc2)N2C(c3cccs3)OC[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23NOS/c1-4-11-20(12-5-1)23-19-28-26(24-17-10-18-29-24)27(23)25(21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-18,23,25-26H,19H2/t23-,26?/m0/s1 |
| InChIKey | BSHJWPGYRJSXGF-ZZHFZYNASA-N |
| XLogP | 6.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |