C25H25NO4S — CID 11553860
dimethyl (2R,5R)-1-benzyl-2-phenyl-5-thiophen-2-ylpyrrolidine-3,3-dicarboxylate (PubChem CID 11553860) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is dimethyl (2R,5R)-1-benzyl-2-phenyl-5-thiophen-2-ylpyrrolidine-3,3-dicarboxylate.
| Compound Name | dimethyl (2R,5R)-1-benzyl-2-phenyl-5-thiophen-2-ylpyrrolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 11553860 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | dimethyl (2R,5R)-1-benzyl-2-phenyl-5-thiophen-2-ylpyrrolidine-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](c2cccs2)N(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H25NO4S/c1-29-23(27)25(24(28)30-2)16-20(21-14-9-15-31-21)26(17-18-10-5-3-6-11-18)22(25)19-12-7-4-8-13-19/h3-15,20,22H,16-17H2,1-2H3/t20-,22-/m1/s1 |
| InChIKey | KGXCEPAZWMJLGG-IFMALSPDSA-N |
| XLogP | 4.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|