C18H18O5S — CID 11537523
dimethyl (2S,5R)-5-phenyl-2-thiophen-2-yloxolane-3,3-dicarboxylate (PubChem CID 11537523) has the molecular formula C18H18O5S and a molecular weight of 346.40 g/mol. Its IUPAC name is dimethyl (2S,5R)-5-phenyl-2-thiophen-2-yloxolane-3,3-dicarboxylate.
| Compound Name | dimethyl (2S,5R)-5-phenyl-2-thiophen-2-yloxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 11537523 |
| Molecular Formula | C18H18O5S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | dimethyl (2S,5R)-5-phenyl-2-thiophen-2-yloxolane-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](c2ccccc2)O[C@@H]1c1cccs1 |
| InChI | InChI=1S/C18H18O5S/c1-21-16(19)18(17(20)22-2)11-13(12-7-4-3-5-8-12)23-15(18)14-9-6-10-24-14/h3-10,13,15H,11H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | UCTHCLFCPMPCBN-UKRRQHHQSA-N |
| XLogP | 3.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|