C22H21NO6S — CID 10455212
dimethyl (3S,6R)-3-(furan-2-yl)-2-phenyl-6-thiophen-2-yloxazinane-4,4-dicarboxylate (PubChem CID 10455212) has the molecular formula C22H21NO6S and a molecular weight of 427.48 g/mol. Its IUPAC name is dimethyl (3S,6R)-3-(furan-2-yl)-2-phenyl-6-thiophen-2-yloxazinane-4,4-dicarboxylate.
| Compound Name | dimethyl (3S,6R)-3-(furan-2-yl)-2-phenyl-6-thiophen-2-yloxazinane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 10455212 |
| Molecular Formula | C22H21NO6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | dimethyl (3S,6R)-3-(furan-2-yl)-2-phenyl-6-thiophen-2-yloxazinane-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](c2cccs2)ON(c2ccccc2)[C@@H]1c1ccco1 |
| InChI | InChI=1S/C22H21NO6S/c1-26-20(24)22(21(25)27-2)14-17(18-11-7-13-30-18)29-23(15-8-4-3-5-9-15)19(22)16-10-6-12-28-16/h3-13,17,19H,14H2,1-2H3/t17-,19-/m1/s1 |
| InChIKey | ORWBOKFMHAYXEH-IEBWSBKVSA-N |
| XLogP | 4.30 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|