C20H23NO5S — CID 10000412
diethyl (3S)-2-phenyl-3-thiophen-2-yloxazinane-4,4-dicarboxylate (PubChem CID 10000412) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is diethyl (3S)-2-phenyl-3-thiophen-2-yloxazinane-4,4-dicarboxylate.
| Compound Name | diethyl (3S)-2-phenyl-3-thiophen-2-yloxazinane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 10000412 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | diethyl (3S)-2-phenyl-3-thiophen-2-yloxazinane-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCON(c2ccccc2)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C20H23NO5S/c1-3-24-18(22)20(19(23)25-4-2)12-13-26-21(15-9-6-5-7-10-15)17(20)16-11-8-14-27-16/h5-11,14,17H,3-4,12-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | KMBXHWTZMWLEOI-QGZVFWFLSA-N |
| XLogP | 3.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|