C23H27NO5 — CID 12062650
diethyl (3R)-2-(4-methylphenyl)-3-phenyloxazinane-4,4-dicarboxylate (PubChem CID 12062650) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is diethyl (3R)-2-(4-methylphenyl)-3-phenyloxazinane-4,4-dicarboxylate.
| Compound Name | diethyl (3R)-2-(4-methylphenyl)-3-phenyloxazinane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 12062650 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | diethyl (3R)-2-(4-methylphenyl)-3-phenyloxazinane-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCON(c2ccc(C)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H27NO5/c1-4-27-21(25)23(22(26)28-5-2)15-16-29-24(19-13-11-17(3)12-14-19)20(23)18-9-7-6-8-10-18/h6-14,20H,4-5,15-16H2,1-3H3/t20-/m1/s1 |
| InChIKey | GADGNFPMGCAQLJ-HXUWFJFHSA-N |
| XLogP | 3.99 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|