C27H33NO5 — CID 102143488
dimethyl 6-[(E)-hex-1-enyl]-3-(4-methylphenyl)-2-phenyloxazinane-4,4-dicarboxylate (PubChem CID 102143488) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is dimethyl 6-[(E)-hex-1-enyl]-3-(4-methylphenyl)-2-phenyloxazinane-4,4-dicarboxylate.
| Compound Name | dimethyl 6-[(E)-hex-1-enyl]-3-(4-methylphenyl)-2-phenyloxazinane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 102143488 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | dimethyl 6-[(E)-hex-1-enyl]-3-(4-methylphenyl)-2-phenyloxazinane-4,4-dicarboxylate |
| SMILES | CCCC/C=C/C1CC(C(=O)OC)(C(=O)OC)C(c2ccc(C)cc2)N(c2ccccc2)O1 |
| InChI | InChI=1S/C27H33NO5/c1-5-6-7-11-14-23-19-27(25(29)31-3,26(30)32-4)24(21-17-15-20(2)16-18-21)28(33-23)22-12-9-8-10-13-22/h8-18,23-24H,5-7,19H2,1-4H3/b14-11+ |
| InChIKey | YRWTUYDVNNQOGS-SDNWHVSQSA-N |
| XLogP | 5.33 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|