C22H23NO7 — CID 122221499
dimethyl 6-(1,3-benzodioxol-5-yl)-2-methyl-3-phenyloxazinane-4,4-dicarboxylate (PubChem CID 122221499) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is dimethyl 6-(1,3-benzodioxol-5-yl)-2-methyl-3-phenyloxazinane-4,4-dicarboxylate.
| Compound Name | dimethyl 6-(1,3-benzodioxol-5-yl)-2-methyl-3-phenyloxazinane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 122221499 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | dimethyl 6-(1,3-benzodioxol-5-yl)-2-methyl-3-phenyloxazinane-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(c2ccc3c(c2)OCO3)ON(C)C1c1ccccc1 |
| InChI | InChI=1S/C22H23NO7/c1-23-19(14-7-5-4-6-8-14)22(20(24)26-2,21(25)27-3)12-18(30-23)15-9-10-16-17(11-15)29-13-28-16/h4-11,18-19H,12-13H2,1-3H3 |
| InChIKey | MLXQLDICEBOWPL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|