C23H23NO8 — CID 101489912
dimethyl (1R,11R)-13-[(4-methoxyphenyl)methyl]-5,7,12-trioxa-13-azatetracyclo[9.2.2.02,10.04,8]pentadeca-2,4(8),9-triene-14,14-dicarboxylate (PubChem CID 101489912) has the molecular formula C23H23NO8 and a molecular weight of 441.44 g/mol. Its IUPAC name is dimethyl (1R,11R)-13-[(4-methoxyphenyl)methyl]-5,7,12-trioxa-13-azatetracyclo[9.2.2.02,10.04,8]pentadeca-2,4(8),9-triene-14,14-dicarboxylate.
| Compound Name | dimethyl (1R,11R)-13-[(4-methoxyphenyl)methyl]-5,7,12-trioxa-13-azatetracyclo[9.2.2.02,10.04,8]pentadeca-2,4(8),9-triene-14,14-dicarboxylate |
|---|---|
| PubChem CID | 101489912 |
| Molecular Formula | C23H23NO8 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | dimethyl (1R,11R)-13-[(4-methoxyphenyl)methyl]-5,7,12-trioxa-13-azatetracyclo[9.2.2.02,10.04,8]pentadeca-2,4(8),9-triene-14,14-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H]2ON(Cc3ccc(OC)cc3)[C@@H]1c1cc3c(cc12)OCO3 |
| InChI | InChI=1S/C23H23NO8/c1-27-14-6-4-13(5-7-14)11-24-20-16-9-18-17(30-12-31-18)8-15(16)19(32-24)10-23(20,21(25)28-2)22(26)29-3/h4-9,19-20H,10-12H2,1-3H3/t19-,20-/m1/s1 |
| InChIKey | UCCUMCOGMYYVIB-WOJBJXKFSA-N |
| XLogP | 2.69 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|