C20H19N3O6 — CID 75531893
N-(1,3-benzodioxol-5-yl)-2-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 75531893) has the molecular formula C20H19N3O6 and a molecular weight of 397.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 75531893 |
| Molecular Formula | C20H19N3O6 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | COc1ccc(CN2C(=O)NC(CC(=O)Nc3ccc4c(c3)OCO4)C2=O)cc1 |
| InChI | InChI=1S/C20H19N3O6/c1-27-14-5-2-12(3-6-14)10-23-19(25)15(22-20(23)26)9-18(24)21-13-4-7-16-17(8-13)29-11-28-16/h2-8,15H,9-11H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | PBBWDGQVKDEEOY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|