C21H21N5O4 — CID 71709403
2-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-methylbenzimidazol-5-yl)acetamide (PubChem CID 71709403) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is 2-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-methylbenzimidazol-5-yl)acetamide.
| Compound Name | 2-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-methylbenzimidazol-5-yl)acetamide |
|---|---|
| PubChem CID | 71709403 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-methylbenzimidazol-5-yl)acetamide |
| SMILES | COc1ccc(CN2C(=O)NC(CC(=O)Nc3ccc4c(c3)ncn4C)C2=O)cc1 |
| InChI | InChI=1S/C21H21N5O4/c1-25-12-22-16-9-14(5-8-18(16)25)23-19(27)10-17-20(28)26(21(29)24-17)11-13-3-6-15(30-2)7-4-13/h3-9,12,17H,10-11H2,1-2H3,(H,23,27)(H,24,29) |
| InChIKey | AYVOXGOHFGQYIF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|