C23H25N5O4 — CID 91640478
3-[(4S)-1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-methylbenzimidazol-5-yl)propanamide (PubChem CID 91640478) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-[(4S)-1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-methylbenzimidazol-5-yl)propanamide.
| Compound Name | 3-[(4S)-1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-methylbenzimidazol-5-yl)propanamide |
|---|---|
| PubChem CID | 91640478 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 3-[(4S)-1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-methylbenzimidazol-5-yl)propanamide |
| SMILES | COc1ccc(CCN2C(=O)N[C@@H](CCC(=O)Nc3ccc4c(c3)ncn4C)C2=O)cc1 |
| InChI | InChI=1S/C23H25N5O4/c1-27-14-24-19-13-16(5-9-20(19)27)25-21(29)10-8-18-22(30)28(23(31)26-18)12-11-15-3-6-17(32-2)7-4-15/h3-7,9,13-14,18H,8,10-12H2,1-2H3,(H,25,29)(H,26,31)/t18-/m0/s1 |
| InChIKey | FJPFCIOVVRNNKT-SFHVURJKSA-N |
| XLogP | 2.46 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|