C20H21FN4O4 — CID 91641060
3-[(4S)-1-[2-(3-fluorophenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(6-methoxy-3-pyridinyl)propanamide (PubChem CID 91641060) has the molecular formula C20H21FN4O4 and a molecular weight of 400.41 g/mol. Its IUPAC name is 3-[(4S)-1-[2-(3-fluorophenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(6-methoxy-3-pyridinyl)propanamide.
| Compound Name | 3-[(4S)-1-[2-(3-fluorophenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(6-methoxy-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 91641060 |
| Molecular Formula | C20H21FN4O4 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 3-[(4S)-1-[2-(3-fluorophenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(6-methoxy-3-pyridinyl)propanamide |
| SMILES | COc1ccc(NC(=O)CC[C@@H]2NC(=O)N(CCc3cccc(F)c3)C2=O)cn1 |
| InChI | InChI=1S/C20H21FN4O4/c1-29-18-8-5-15(12-22-18)23-17(26)7-6-16-19(27)25(20(28)24-16)10-9-13-3-2-4-14(21)11-13/h2-5,8,11-12,16H,6-7,9-10H2,1H3,(H,23,26)(H,24,28)/t16-/m0/s1 |
| InChIKey | LMOLSAIXHZEHMA-INIZCTEOSA-N |
| XLogP | 2.11 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|