C22H26N4O5 — CID 124864039
3-[(4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(6-methyl-2-pyridinyl)propanamide (PubChem CID 124864039) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is 3-[(4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(6-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[(4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(6-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 124864039 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-[(4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(6-methyl-2-pyridinyl)propanamide |
| SMILES | COc1ccc(CCN2C(=O)N[C@H](CCC(=O)Nc3cccc(C)n3)C2=O)cc1OC |
| InChI | InChI=1S/C22H26N4O5/c1-14-5-4-6-19(23-14)25-20(27)10-8-16-21(28)26(22(29)24-16)12-11-15-7-9-17(30-2)18(13-15)31-3/h4-7,9,13,16H,8,10-12H2,1-3H3,(H,24,29)(H,23,25,27)/t16-/m1/s1 |
| InChIKey | VWSMTMFGSXZBIE-MRXNPFEDSA-N |
| XLogP | 2.29 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|